About CID 11093162
CID 11093162 (PubChem CID 11093162) has the molecular formula C26H34Cl2N2Si2Zr+
and a molecular weight of 592.87 g/mol.
Molecular Properties
| Compound Name | CID 11093162 |
| PubChem CID | 11093162 |
| Molecular Formula | C26H34Cl2N2Si2Zr+ |
| Molecular Weight | 592.87 g/mol |
| Exact Mass | 590.07 |
| IUPAC Name | — |
| SMILES | C[Si](C)(C)/N=C(/C=C(\[N-][Si](C)(C)C)c1ccccc1)c1ccccc1.Cl[Zr+2]Cl.[CH]1[CH][CH][CH][CH]1 |
| InChI | InChI=1S/C21H29N2Si2.C5H5.2ClH.Zr/c1-24(2,3)22-20(18-13-9-7-10-14-18)17-21(23-25(4,5)6)19-15-11-8-12-16-19;1-2-4-5-3-1;;;/h7-17H,1-6H3;1-5H;2*1H;/q-1;;;;+4/p-2/b20-17-,23-21-;;;; |
| InChIKey | DOKMSRABXKCXFQ-VRWNYIIJSA-L |
| XLogP | 8.96 |
| TPSA | 26.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 592.87 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze CID 11093162 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11093162?
The IUPAC name of CID 11093162 (CID 11093162) is not available.
What is the SMILES notation for CID 11093162?
The canonical SMILES for CID 11093162 is C[Si](C)(C)/N=C(/C=C(\[N-][Si](C)(C)C)c1ccccc1)c1ccccc1.Cl[Zr+2]Cl.[CH]1[CH][CH][CH][CH]1.
What is the InChIKey of CID 11093162?
The InChIKey is DOKMSRABXKCXFQ-VRWNYIIJSA-L. The full InChI is InChI=1S/C21H29N2Si2.C5H5.2ClH.Zr/c1-24(2,3)22-20(18-13-9-7-10-14-18)17-21(23-25(4,5)6)19-15-11-8-12-16-19;1-2-4-5-3-1;;;/h7-17H,1-6H3;1-5H;2*1H;/q-1;;;;+4/p-2/b20-17-,23-21-;;;;.
What are the key properties of CID 11093162?
CID 11093162 has a molecular weight of 592.87 g/mol, XLogP of 8.96, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11093162 is sourced from PubChem (CID 11093162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).