C14H17BrN2O2 — CID 110932920
2-[[2-(4-bromophenyl)-1,3-oxazol-4-yl]methyl-ethylamino]ethanol (PubChem CID 110932920) has the molecular formula C14H17BrN2O2 and a molecular weight of 325.21 g/mol. Its IUPAC name is 2-[[2-(4-bromophenyl)-1,3-oxazol-4-yl]methyl-ethylamino]ethanol.
| Compound Name | 2-[[2-(4-bromophenyl)-1,3-oxazol-4-yl]methyl-ethylamino]ethanol |
|---|---|
| PubChem CID | 110932920 |
| Molecular Formula | C14H17BrN2O2 |
| Molecular Weight | 325.21 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | 2-[[2-(4-bromophenyl)-1,3-oxazol-4-yl]methyl-ethylamino]ethanol |
| SMILES | CCN(CCO)Cc1coc(-c2ccc(Br)cc2)n1 |
| InChI | InChI=1S/C14H17BrN2O2/c1-2-17(7-8-18)9-13-10-19-14(16-13)11-3-5-12(15)6-4-11/h3-6,10,18H,2,7-9H2,1H3 |
| InChIKey | GMGOLIUSGLKAQT-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 49.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.21 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |