C11H18N4O2S — CID 110932980
1-(5-ethyl-1,3,4-thiadiazol-2-yl)-3-(2-hydroxycyclohexyl)urea (PubChem CID 110932980) has the molecular formula C11H18N4O2S and a molecular weight of 270.36 g/mol. Its IUPAC name is 1-(5-ethyl-1,3,4-thiadiazol-2-yl)-3-(2-hydroxycyclohexyl)urea.
| Compound Name | 1-(5-ethyl-1,3,4-thiadiazol-2-yl)-3-(2-hydroxycyclohexyl)urea |
|---|---|
| PubChem CID | 110932980 |
| Molecular Formula | C11H18N4O2S |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 1-(5-ethyl-1,3,4-thiadiazol-2-yl)-3-(2-hydroxycyclohexyl)urea |
| SMILES | CCc1nnc(NC(=O)NC2CCCCC2O)s1 |
| InChI | InChI=1S/C11H18N4O2S/c1-2-9-14-15-11(18-9)13-10(17)12-7-5-3-4-6-8(7)16/h7-8,16H,2-6H2,1H3,(H2,12,13,15,17) |
| InChIKey | FRDSNHWBCGXXKY-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |