C28H30B2F3N3O8 — CID 11093307
[2-[(E)-[3-[(E)-(2-(10B)boronophenyl)methylideneamino]oxy-4-(piperidin-1-ium-1-ylmethyl)phenoxy]iminomethyl]phenyl](10B)boronic acid;2,2,2-trifluoroacetate (PubChem CID 11093307) has the molecular formula C28H30B2F3N3O8 and a molecular weight of 614.57 g/mol. Its IUPAC name is [2-[(E)-[3-[(E)-(2-(10B)boronophenyl)methylideneamino]oxy-4-(piperidin-1-ium-1-ylmethyl)phenoxy]iminomethyl]phenyl](10B)boronic acid;2,2,2-trifluoroacetate.
| Compound Name | [2-[(E)-[3-[(E)-(2-(10B)boronophenyl)methylideneamino]oxy-4-(piperidin-1-ium-1-ylmethyl)phenoxy]iminomethyl]phenyl](10B)boronic acid;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 11093307 |
| Molecular Formula | C28H30B2F3N3O8 |
| Molecular Weight | 614.57 g/mol |
| Exact Mass | 614.22 |
| IUPAC Name | [2-[(E)-[3-[(E)-(2-(10B)boronophenyl)methylideneamino]oxy-4-(piperidin-1-ium-1-ylmethyl)phenoxy]iminomethyl]phenyl](10B)boronic acid;2,2,2-trifluoroacetate |
| SMILES | O=C([O-])C(F)(F)F.O[10B](O)c1ccccc1/C=N/Oc1cc(O/[15N]=C/c2ccccc2[10B](O)O)ccc1C[NH+]1CCCCC1 |
| InChI | InChI=1S/C26H29B2N3O6.C2HF3O2/c32-27(33)24-10-4-2-8-20(24)17-29-36-23-13-12-22(19-31-14-6-1-7-15-31)26(16-23)37-30-18-21-9-3-5-11-25(21)28(34)35;3-2(4,5)1(6)7/h2-5,8-13,16-18,32-35H,1,6-7,14-15,19H2;(H,6,7)/b29-17+,30-18+;/i27-1,28-1,29+1; |
| InChIKey | WBYQRYUHZYHEDP-GSNRMSGFSA-N |
| XLogP | -1.26 |
| TPSA | 168.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.57 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|