C18H28N2O3 — CID 110933256
1-(2-hydroxycyclohexyl)-3-[1-(4-propan-2-yloxyphenyl)ethyl]urea (PubChem CID 110933256) has the molecular formula C18H28N2O3 and a molecular weight of 320.43 g/mol. Its IUPAC name is 1-(2-hydroxycyclohexyl)-3-[1-(4-propan-2-yloxyphenyl)ethyl]urea.
| Compound Name | 1-(2-hydroxycyclohexyl)-3-[1-(4-propan-2-yloxyphenyl)ethyl]urea |
|---|---|
| PubChem CID | 110933256 |
| Molecular Formula | C18H28N2O3 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | 1-(2-hydroxycyclohexyl)-3-[1-(4-propan-2-yloxyphenyl)ethyl]urea |
| SMILES | CC(C)Oc1ccc(C(C)NC(=O)NC2CCCCC2O)cc1 |
| InChI | InChI=1S/C18H28N2O3/c1-12(2)23-15-10-8-14(9-11-15)13(3)19-18(22)20-16-6-4-5-7-17(16)21/h8-13,16-17,21H,4-7H2,1-3H3,(H2,19,20,22) |
| InChIKey | DZPKZBRQVMYBQH-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |