C18H25N3O3 — CID 110933741
1-(furan-2-ylmethyl)-3-[(3-methoxy-4-propoxyphenyl)methyl]-2-methylguanidine (PubChem CID 110933741) has the molecular formula C18H25N3O3 and a molecular weight of 331.42 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-3-[(3-methoxy-4-propoxyphenyl)methyl]-2-methylguanidine.
| Compound Name | 1-(furan-2-ylmethyl)-3-[(3-methoxy-4-propoxyphenyl)methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 110933741 |
| Molecular Formula | C18H25N3O3 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | 1-(furan-2-ylmethyl)-3-[(3-methoxy-4-propoxyphenyl)methyl]-2-methylguanidine |
| SMILES | CCCOc1ccc(CN/C(=N/C)NCc2ccco2)cc1OC |
| InChI | InChI=1S/C18H25N3O3/c1-4-9-24-16-8-7-14(11-17(16)22-3)12-20-18(19-2)21-13-15-6-5-10-23-15/h5-8,10-11H,4,9,12-13H2,1-3H3,(H2,19,20,21) |
| InChIKey | TZGZACCMZVGVMT-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|