C16H27N3O3 — CID 110935047
1,3-diethyl-2-[2-(2,3,4-trimethoxyphenyl)ethyl]guanidine (PubChem CID 110935047) has the molecular formula C16H27N3O3 and a molecular weight of 309.41 g/mol. Its IUPAC name is 1,3-diethyl-2-[2-(2,3,4-trimethoxyphenyl)ethyl]guanidine.
| Compound Name | 1,3-diethyl-2-[2-(2,3,4-trimethoxyphenyl)ethyl]guanidine |
|---|---|
| PubChem CID | 110935047 |
| Molecular Formula | C16H27N3O3 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | 1,3-diethyl-2-[2-(2,3,4-trimethoxyphenyl)ethyl]guanidine |
| SMILES | CCNC(=NCCc1ccc(OC)c(OC)c1OC)NCC |
| InChI | InChI=1S/C16H27N3O3/c1-6-17-16(18-7-2)19-11-10-12-8-9-13(20-3)15(22-5)14(12)21-4/h8-9H,6-7,10-11H2,1-5H3,(H2,17,18,19) |
| InChIKey | CPLREBUZTIQOFP-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|