C33H35N3O11 — CID 11093509
2-[4-[[2-acetamido-3-[4-(2-carboxy-N-oxaloanilino)-3-ethylphenyl]propanoyl]amino]butoxy]-6-hydroxybenzoic acid (PubChem CID 11093509) has the molecular formula C33H35N3O11 and a molecular weight of 649.65 g/mol. Its IUPAC name is 2-[4-[[2-acetamido-3-[4-(2-carboxy-N-oxaloanilino)-3-ethylphenyl]propanoyl]amino]butoxy]-6-hydroxybenzoic acid.
| Compound Name | 2-[4-[[2-acetamido-3-[4-(2-carboxy-N-oxaloanilino)-3-ethylphenyl]propanoyl]amino]butoxy]-6-hydroxybenzoic acid |
|---|---|
| PubChem CID | 11093509 |
| Molecular Formula | C33H35N3O11 |
| Molecular Weight | 649.65 g/mol |
| Exact Mass | 649.23 |
| IUPAC Name | 2-[4-[[2-acetamido-3-[4-(2-carboxy-N-oxaloanilino)-3-ethylphenyl]propanoyl]amino]butoxy]-6-hydroxybenzoic acid |
| SMILES | CCc1cc(CC(NC(C)=O)C(=O)NCCCCOc2cccc(O)c2C(=O)O)ccc1N(C(=O)C(=O)O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C33H35N3O11/c1-3-21-17-20(13-14-24(21)36(30(40)33(45)46)25-10-5-4-9-22(25)31(41)42)18-23(35-19(2)37)29(39)34-15-6-7-16-47-27-12-8-11-26(38)28(27)32(43)44/h4-5,8-14,17,23,38H,3,6-7,15-16,18H2,1-2H3,(H,34,39)(H,35,37)(H,41,42)(H,43,44)(H,45,46) |
| InChIKey | HMUGMCSGKHKDGY-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 219.87 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.65 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|