C16H22N2O3 — CID 110936269
1-(2,3-dihydro-1H-inden-5-yl)-3-[(4-hydroxyoxan-4-yl)methyl]urea (PubChem CID 110936269) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-5-yl)-3-[(4-hydroxyoxan-4-yl)methyl]urea.
| Compound Name | 1-(2,3-dihydro-1H-inden-5-yl)-3-[(4-hydroxyoxan-4-yl)methyl]urea |
|---|---|
| PubChem CID | 110936269 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-5-yl)-3-[(4-hydroxyoxan-4-yl)methyl]urea |
| SMILES | O=C(NCC1(O)CCOCC1)Nc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C16H22N2O3/c19-15(17-11-16(20)6-8-21-9-7-16)18-14-5-4-12-2-1-3-13(12)10-14/h4-5,10,20H,1-3,6-9,11H2,(H2,17,18,19) |
| InChIKey | XHTHTLVKGRRQRS-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |