C19H30N2O3 — CID 110936623
1-[1-(4-tert-butylphenyl)ethyl]-3-[(4-hydroxyoxan-4-yl)methyl]urea (PubChem CID 110936623) has the molecular formula C19H30N2O3 and a molecular weight of 334.46 g/mol. Its IUPAC name is 1-[1-(4-tert-butylphenyl)ethyl]-3-[(4-hydroxyoxan-4-yl)methyl]urea.
| Compound Name | 1-[1-(4-tert-butylphenyl)ethyl]-3-[(4-hydroxyoxan-4-yl)methyl]urea |
|---|---|
| PubChem CID | 110936623 |
| Molecular Formula | C19H30N2O3 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | 1-[1-(4-tert-butylphenyl)ethyl]-3-[(4-hydroxyoxan-4-yl)methyl]urea |
| SMILES | CC(NC(=O)NCC1(O)CCOCC1)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C19H30N2O3/c1-14(15-5-7-16(8-6-15)18(2,3)4)21-17(22)20-13-19(23)9-11-24-12-10-19/h5-8,14,23H,9-13H2,1-4H3,(H2,20,21,22) |
| InChIKey | YMNFTGQAQYMBNZ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |