C21H36N4O3 — CID 110936781
tert-butyl N-[3-[[amino-[2-(4-methoxyphenyl)ethylamino]methylidene]amino]propyl]-N-propan-2-ylcarbamate (PubChem CID 110936781) has the molecular formula C21H36N4O3 and a molecular weight of 392.54 g/mol. Its IUPAC name is tert-butyl N-[3-[[amino-[2-(4-methoxyphenyl)ethylamino]methylidene]amino]propyl]-N-propan-2-ylcarbamate.
| Compound Name | tert-butyl N-[3-[[amino-[2-(4-methoxyphenyl)ethylamino]methylidene]amino]propyl]-N-propan-2-ylcarbamate |
|---|---|
| PubChem CID | 110936781 |
| Molecular Formula | C21H36N4O3 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.28 |
| IUPAC Name | tert-butyl N-[3-[[amino-[2-(4-methoxyphenyl)ethylamino]methylidene]amino]propyl]-N-propan-2-ylcarbamate |
| SMILES | COc1ccc(CCN/C(N)=N/CCCN(C(=O)OC(C)(C)C)C(C)C)cc1 |
| InChI | InChI=1S/C21H36N4O3/c1-16(2)25(20(26)28-21(3,4)5)15-7-13-23-19(22)24-14-12-17-8-10-18(27-6)11-9-17/h8-11,16H,7,12-15H2,1-6H3,(H3,22,23,24) |
| InChIKey | DEYWBPXSZMTDAJ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|