C18H26IN3O3 — CID 110937359
1-[2-(2,5-dimethoxyphenyl)ethyl]-3-ethyl-2-(furan-2-ylmethyl)guanidine;hydroiodide (PubChem CID 110937359) has the molecular formula C18H26IN3O3 and a molecular weight of 459.33 g/mol. Its IUPAC name is 1-[2-(2,5-dimethoxyphenyl)ethyl]-3-ethyl-2-(furan-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(2,5-dimethoxyphenyl)ethyl]-3-ethyl-2-(furan-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110937359 |
| Molecular Formula | C18H26IN3O3 |
| Molecular Weight | 459.33 g/mol |
| Exact Mass | 459.10 |
| IUPAC Name | 1-[2-(2,5-dimethoxyphenyl)ethyl]-3-ethyl-2-(furan-2-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccco1)NCCc1cc(OC)ccc1OC.I |
| InChI | InChI=1S/C18H25N3O3.HI/c1-4-19-18(21-13-16-6-5-11-24-16)20-10-9-14-12-15(22-2)7-8-17(14)23-3;/h5-8,11-12H,4,9-10,13H2,1-3H3,(H2,19,20,21);1H |
| InChIKey | MZLHOHPHEAFMAS-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.33 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|