About N'-[2,6-di(piperidin-1-yl)pyrimidin-4-yl]-3-phenylpropanehydrazide
N'-[2,6-di(piperidin-1-yl)pyrimidin-4-yl]-3-phenylpropanehydrazide (PubChem CID 1109397) has the molecular formula C23H32N6O
and a molecular weight of 408.55 g/mol. Its IUPAC name is N'-[2,6-di(piperidin-1-yl)pyrimidin-4-yl]-3-phenylpropanehydrazide.
Molecular Properties
| Compound Name | N'-[2,6-di(piperidin-1-yl)pyrimidin-4-yl]-3-phenylpropanehydrazide |
| PubChem CID | 1109397 |
| Molecular Formula | C23H32N6O |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.26 |
| IUPAC Name | N'-[2,6-di(piperidin-1-yl)pyrimidin-4-yl]-3-phenylpropanehydrazide |
| SMILES | O=C(CCc1ccccc1)NNc1cc(N2CCCCC2)nc(N2CCCCC2)n1 |
| InChI | InChI=1S/C23H32N6O/c30-22(13-12-19-10-4-1-5-11-19)27-26-20-18-21(28-14-6-2-7-15-28)25-23(24-20)29-16-8-3-9-17-29/h1,4-5,10-11,18H,2-3,6-9,12-17H2,(H,27,30)(H,24,25,26) |
| InChIKey | JZRIETCEGKDUCH-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-[2,6-di(piperidin-1-yl)pyrimidin-4-yl]-3-phenylpropanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[2,6-di(piperidin-1-yl)pyrimidin-4-yl]-3-phenylpropanehydrazide?
The IUPAC name of N'-[2,6-di(piperidin-1-yl)pyrimidin-4-yl]-3-phenylpropanehydrazide (CID 1109397) is N'-[2,6-di(piperidin-1-yl)pyrimidin-4-yl]-3-phenylpropanehydrazide.
What is the SMILES notation for N'-[2,6-di(piperidin-1-yl)pyrimidin-4-yl]-3-phenylpropanehydrazide?
The canonical SMILES for N'-[2,6-di(piperidin-1-yl)pyrimidin-4-yl]-3-phenylpropanehydrazide is O=C(CCc1ccccc1)NNc1cc(N2CCCCC2)nc(N2CCCCC2)n1.
What is the InChIKey of N'-[2,6-di(piperidin-1-yl)pyrimidin-4-yl]-3-phenylpropanehydrazide?
The InChIKey is JZRIETCEGKDUCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H32N6O/c30-22(13-12-19-10-4-1-5-11-19)27-26-20-18-21(28-14-6-2-7-15-28)25-23(24-20)29-16-8-3-9-17-29/h1,4-5,10-11,18H,2-3,6-9,12-17H2,(H,27,30)(H,24,25,26).
What are the key properties of N'-[2,6-di(piperidin-1-yl)pyrimidin-4-yl]-3-phenylpropanehydrazide?
N'-[2,6-di(piperidin-1-yl)pyrimidin-4-yl]-3-phenylpropanehydrazide has a molecular weight of 408.55 g/mol, XLogP of 3.53, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[2,6-di(piperidin-1-yl)pyrimidin-4-yl]-3-phenylpropanehydrazide is sourced from PubChem (CID 1109397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).