C16H23IN4O2 — CID 110940635
2-[[ethylamino-(2-methoxyethylamino)methylidene]amino]-N-(3-ethynylphenyl)acetamide;hydroiodide (PubChem CID 110940635) has the molecular formula C16H23IN4O2 and a molecular weight of 430.29 g/mol. Its IUPAC name is 2-[[ethylamino-(2-methoxyethylamino)methylidene]amino]-N-(3-ethynylphenyl)acetamide;hydroiodide.
| Compound Name | 2-[[ethylamino-(2-methoxyethylamino)methylidene]amino]-N-(3-ethynylphenyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 110940635 |
| Molecular Formula | C16H23IN4O2 |
| Molecular Weight | 430.29 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | 2-[[ethylamino-(2-methoxyethylamino)methylidene]amino]-N-(3-ethynylphenyl)acetamide;hydroiodide |
| SMILES | C#Cc1cccc(NC(=O)C/N=C(\NCC)NCCOC)c1.I |
| InChI | InChI=1S/C16H22N4O2.HI/c1-4-13-7-6-8-14(11-13)20-15(21)12-19-16(17-5-2)18-9-10-22-3;/h1,6-8,11H,5,9-10,12H2,2-3H3,(H,20,21)(H2,17,18,19);1H |
| InChIKey | OOLZRWHMMROXEF-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.29 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|