C48H64N8O2S4 — CID 11094177
7,23-bis(4-phenylmethoxybutyl)-3,5,9,11,19,21,25,27-octazatricyclo[27.3.1.113,17]tetratriaconta-1(33),13(34),14,16,29,31-hexaene-4,10,20,26-tetrathione (PubChem CID 11094177) has the molecular formula C48H64N8O2S4 and a molecular weight of 913.36 g/mol. Its IUPAC name is 7,23-bis(4-phenylmethoxybutyl)-3,5,9,11,19,21,25,27-octazatricyclo[27.3.1.113,17]tetratriaconta-1(33),13(34),14,16,29,31-hexaene-4,10,20,26-tetrathione.
| Compound Name | 7,23-bis(4-phenylmethoxybutyl)-3,5,9,11,19,21,25,27-octazatricyclo[27.3.1.113,17]tetratriaconta-1(33),13(34),14,16,29,31-hexaene-4,10,20,26-tetrathione |
|---|---|
| PubChem CID | 11094177 |
| Molecular Formula | C48H64N8O2S4 |
| Molecular Weight | 913.36 g/mol |
| Exact Mass | 912.40 |
| IUPAC Name | 7,23-bis(4-phenylmethoxybutyl)-3,5,9,11,19,21,25,27-octazatricyclo[27.3.1.113,17]tetratriaconta-1(33),13(34),14,16,29,31-hexaene-4,10,20,26-tetrathione |
| SMILES | S=C1NCc2cccc(c2)CNC(=S)NCC(CCCCOCc2ccccc2)CNC(=S)NCc2cccc(c2)CNC(=S)NCC(CCCCOCc2ccccc2)CN1 |
| InChI | InChI=1S/C48H64N8O2S4/c59-45-49-27-39-19-11-21-41(25-39)29-51-47(61)55-33-44(18-8-10-24-58-36-38-15-5-2-6-16-38)34-56-48(62)52-30-42-22-12-20-40(26-42)28-50-46(60)54-32-43(31-53-45)17-7-9-23-57-35-37-13-3-1-4-14-37/h1-6,11-16,19-22,25-26,43-44H,7-10,17-18,23-24,27-36H2,(H2,49,53,59)(H2,50,54,60)(H2,51,55,61)(H2,52,56,62) |
| InChIKey | ZGPNRBCQBINUCG-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 114.70 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 913.36 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|