C13H26IN5O — CID 110942411
1-ethyl-3-(2-methoxyethyl)-2-(2-methyl-3-pyrazol-1-ylpropyl)guanidine;hydroiodide (PubChem CID 110942411) has the molecular formula C13H26IN5O and a molecular weight of 395.29 g/mol. Its IUPAC name is 1-ethyl-3-(2-methoxyethyl)-2-(2-methyl-3-pyrazol-1-ylpropyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-(2-methoxyethyl)-2-(2-methyl-3-pyrazol-1-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110942411 |
| Molecular Formula | C13H26IN5O |
| Molecular Weight | 395.29 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | 1-ethyl-3-(2-methoxyethyl)-2-(2-methyl-3-pyrazol-1-ylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)Cn1cccn1)NCCOC.I |
| InChI | InChI=1S/C13H25N5O.HI/c1-4-14-13(15-7-9-19-3)16-10-12(2)11-18-8-5-6-17-18;/h5-6,8,12H,4,7,9-11H2,1-3H3,(H2,14,15,16);1H |
| InChIKey | YULLPAPFIMPUDB-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.29 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|