C13H23IN4O2 — CID 110942461
1-ethyl-3-(2-methoxyethyl)-2-[(6-methoxy-3-pyridinyl)methyl]guanidine;hydroiodide (PubChem CID 110942461) has the molecular formula C13H23IN4O2 and a molecular weight of 394.26 g/mol. Its IUPAC name is 1-ethyl-3-(2-methoxyethyl)-2-[(6-methoxy-3-pyridinyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-(2-methoxyethyl)-2-[(6-methoxy-3-pyridinyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110942461 |
| Molecular Formula | C13H23IN4O2 |
| Molecular Weight | 394.26 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | 1-ethyl-3-(2-methoxyethyl)-2-[(6-methoxy-3-pyridinyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(OC)nc1)NCCOC.I |
| InChI | InChI=1S/C13H22N4O2.HI/c1-4-14-13(15-7-8-18-2)17-10-11-5-6-12(19-3)16-9-11;/h5-6,9H,4,7-8,10H2,1-3H3,(H2,14,15,17);1H |
| InChIKey | IQRMVWGIODGBKM-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.26 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|