C17H29N3O2 — CID 110944670
1-butan-2-yl-2-[2-(3,4-dimethoxyphenyl)ethyl]-3-ethylguanidine (PubChem CID 110944670) has the molecular formula C17H29N3O2 and a molecular weight of 307.44 g/mol. Its IUPAC name is 1-butan-2-yl-2-[2-(3,4-dimethoxyphenyl)ethyl]-3-ethylguanidine.
| Compound Name | 1-butan-2-yl-2-[2-(3,4-dimethoxyphenyl)ethyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 110944670 |
| Molecular Formula | C17H29N3O2 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.23 |
| IUPAC Name | 1-butan-2-yl-2-[2-(3,4-dimethoxyphenyl)ethyl]-3-ethylguanidine |
| SMILES | CCN/C(=N\CCc1ccc(OC)c(OC)c1)NC(C)CC |
| InChI | InChI=1S/C17H29N3O2/c1-6-13(3)20-17(18-7-2)19-11-10-14-8-9-15(21-4)16(12-14)22-5/h8-9,12-13H,6-7,10-11H2,1-5H3,(H2,18,19,20) |
| InChIKey | ASZZLNHKBXUFRR-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|