C6H8O — CID 11094544
(1S,6R)-7-oxabicyclo[4.1.0]hept-2-ene (PubChem CID 11094544) has the molecular formula C6H8O and a molecular weight of 96.13 g/mol. Its IUPAC name is (1S,6R)-7-oxabicyclo[4.1.0]hept-2-ene.
| Compound Name | (1S,6R)-7-oxabicyclo[4.1.0]hept-2-ene |
|---|---|
| PubChem CID | 11094544 |
| Molecular Formula | C6H8O |
| Molecular Weight | 96.13 g/mol |
| Exact Mass | 96.06 |
| IUPAC Name | (1S,6R)-7-oxabicyclo[4.1.0]hept-2-ene |
| SMILES | C1=C[C@@H]2O[C@@H]2CC1 |
| InChI | InChI=1S/C6H8O/c1-2-4-6-5(3-1)7-6/h1,3,5-6H,2,4H2/t5-,6+/m0/s1 |
| InChIKey | ILSLNOWZSKKNJQ-NTSWFWBYSA-N |
| XLogP | 1.10 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 96.13 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|