About [(2R)-3,3-dimethyloxiran-2-yl]methanol
[(2R)-3,3-dimethyloxiran-2-yl]methanol (PubChem CID 11094552) has the molecular formula C5H10O2
and a molecular weight of 102.13 g/mol. Its IUPAC name is [(2R)-3,3-dimethyloxiran-2-yl]methanol.
Molecular Properties
| Compound Name | [(2R)-3,3-dimethyloxiran-2-yl]methanol |
| PubChem CID | 11094552 |
| Molecular Formula | C5H10O2 |
| Molecular Weight | 102.13 g/mol |
| Exact Mass | 102.07 |
| IUPAC Name | [(2R)-3,3-dimethyloxiran-2-yl]methanol |
| SMILES | CC1(C)O[C@@H]1CO |
| InChI | InChI=1S/C5H10O2/c1-5(2)4(3-6)7-5/h4,6H,3H2,1-2H3/t4-/m1/s1 |
| InChIKey | HJXAWVLTVYGIBH-SCSAIBSYSA-N |
| XLogP | 0.16 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 102.13 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze [(2R)-3,3-dimethyloxiran-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-3,3-dimethyloxiran-2-yl]methanol?
The IUPAC name of [(2R)-3,3-dimethyloxiran-2-yl]methanol (CID 11094552) is [(2R)-3,3-dimethyloxiran-2-yl]methanol.
What is the SMILES notation for [(2R)-3,3-dimethyloxiran-2-yl]methanol?
The canonical SMILES for [(2R)-3,3-dimethyloxiran-2-yl]methanol is CC1(C)O[C@@H]1CO.
What is the InChIKey of [(2R)-3,3-dimethyloxiran-2-yl]methanol?
The InChIKey is HJXAWVLTVYGIBH-SCSAIBSYSA-N. The full InChI is InChI=1S/C5H10O2/c1-5(2)4(3-6)7-5/h4,6H,3H2,1-2H3/t4-/m1/s1.
What are the key properties of [(2R)-3,3-dimethyloxiran-2-yl]methanol?
[(2R)-3,3-dimethyloxiran-2-yl]methanol has a molecular weight of 102.13 g/mol, XLogP of 0.16, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-3,3-dimethyloxiran-2-yl]methanol is sourced from PubChem (CID 11094552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).