About (1S,8S)-1-methyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizine
(1S,8S)-1-methyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizine (PubChem CID 11094614) has the molecular formula C8H15N
and a molecular weight of 125.22 g/mol. Its IUPAC name is (1S,8S)-1-methyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizine.
Analyze (1S,8S)-1-methyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,8S)-1-methyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizine?
The IUPAC name of (1S,8S)-1-methyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizine (CID 11094614) is (1S,8S)-1-methyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizine.
What is the SMILES notation for (1S,8S)-1-methyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizine?
The canonical SMILES for (1S,8S)-1-methyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizine is C[C@H]1CCN2CCC[C@@H]12.
What is the InChIKey of (1S,8S)-1-methyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizine?
The InChIKey is BFHBAQJJQJPDGF-YUMQZZPRSA-N. The full InChI is InChI=1S/C8H15N/c1-7-4-6-9-5-2-3-8(7)9/h7-8H,2-6H2,1H3/t7-,8-/m0/s1.
What are the key properties of (1S,8S)-1-methyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizine?
(1S,8S)-1-methyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizine has a molecular weight of 125.22 g/mol, XLogP of 1.49, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,8S)-1-methyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizine is sourced from PubChem (CID 11094614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).