C7H11N3 — CID 11094685
[(1R,2R)-2-(1H-imidazol-5-yl)cyclopropyl]methanamine (PubChem CID 11094685) has the molecular formula C7H11N3 and a molecular weight of 137.19 g/mol. Its IUPAC name is [(1R,2R)-2-(1H-imidazol-5-yl)cyclopropyl]methanamine.
| Compound Name | [(1R,2R)-2-(1H-imidazol-5-yl)cyclopropyl]methanamine |
|---|---|
| PubChem CID | 11094685 |
| Molecular Formula | C7H11N3 |
| Molecular Weight | 137.19 g/mol |
| Exact Mass | 137.10 |
| IUPAC Name | [(1R,2R)-2-(1H-imidazol-5-yl)cyclopropyl]methanamine |
| SMILES | NC[C@@H]1C[C@H]1c1cnc[nH]1 |
| InChI | InChI=1S/C7H11N3/c8-2-5-1-6(5)7-3-9-4-10-7/h3-6H,1-2,8H2,(H,9,10)/t5-,6+/m0/s1 |
| InChIKey | LMFNLINKCDGRTE-NTSWFWBYSA-N |
| XLogP | 0.47 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.19 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |