C18H24N4S — CID 110946906
N-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]-N'-methyl-3,4-dihydro-1H-isoquinoline-2-carboximidamide (PubChem CID 110946906) has the molecular formula C18H24N4S and a molecular weight of 328.49 g/mol. Its IUPAC name is N-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]-N'-methyl-3,4-dihydro-1H-isoquinoline-2-carboximidamide.
| Compound Name | N-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]-N'-methyl-3,4-dihydro-1H-isoquinoline-2-carboximidamide |
|---|---|
| PubChem CID | 110946906 |
| Molecular Formula | C18H24N4S |
| Molecular Weight | 328.49 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | N-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]-N'-methyl-3,4-dihydro-1H-isoquinoline-2-carboximidamide |
| SMILES | CCc1nc(CCN/C(=N\C)N2CCc3ccccc3C2)cs1 |
| InChI | InChI=1S/C18H24N4S/c1-3-17-21-16(13-23-17)8-10-20-18(19-2)22-11-9-14-6-4-5-7-15(14)12-22/h4-7,13H,3,8-12H2,1-2H3,(H,19,20) |
| InChIKey | NPFCDDWVKJDVJP-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.49 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|