C22H28N4O2 — CID 110947140
N-[5-[[[3,4-dihydro-1H-isoquinolin-2-yl(ethylamino)methylidene]amino]methyl]-2-methoxyphenyl]acetamide (PubChem CID 110947140) has the molecular formula C22H28N4O2 and a molecular weight of 380.49 g/mol. Its IUPAC name is N-[5-[[[3,4-dihydro-1H-isoquinolin-2-yl(ethylamino)methylidene]amino]methyl]-2-methoxyphenyl]acetamide.
| Compound Name | N-[5-[[[3,4-dihydro-1H-isoquinolin-2-yl(ethylamino)methylidene]amino]methyl]-2-methoxyphenyl]acetamide |
|---|---|
| PubChem CID | 110947140 |
| Molecular Formula | C22H28N4O2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | N-[5-[[[3,4-dihydro-1H-isoquinolin-2-yl(ethylamino)methylidene]amino]methyl]-2-methoxyphenyl]acetamide |
| SMILES | CCN/C(=N\Cc1ccc(OC)c(NC(C)=O)c1)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C22H28N4O2/c1-4-23-22(26-12-11-18-7-5-6-8-19(18)15-26)24-14-17-9-10-21(28-3)20(13-17)25-16(2)27/h5-10,13H,4,11-12,14-15H2,1-3H3,(H,23,24)(H,25,27) |
| InChIKey | VRGJMFOJPZVIPU-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|