C16H20N4S — CID 110947432
N'-methyl-N-[(4-methyl-1,3-thiazol-5-yl)methyl]-3,4-dihydro-1H-isoquinoline-2-carboximidamide (PubChem CID 110947432) has the molecular formula C16H20N4S and a molecular weight of 300.43 g/mol. Its IUPAC name is N'-methyl-N-[(4-methyl-1,3-thiazol-5-yl)methyl]-3,4-dihydro-1H-isoquinoline-2-carboximidamide.
| Compound Name | N'-methyl-N-[(4-methyl-1,3-thiazol-5-yl)methyl]-3,4-dihydro-1H-isoquinoline-2-carboximidamide |
|---|---|
| PubChem CID | 110947432 |
| Molecular Formula | C16H20N4S |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | N'-methyl-N-[(4-methyl-1,3-thiazol-5-yl)methyl]-3,4-dihydro-1H-isoquinoline-2-carboximidamide |
| SMILES | C/N=C(\NCc1scnc1C)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C16H20N4S/c1-12-15(21-11-19-12)9-18-16(17-2)20-8-7-13-5-3-4-6-14(13)10-20/h3-6,11H,7-10H2,1-2H3,(H,17,18) |
| InChIKey | NGHVLXGGBUMNMW-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|