C21H26N4 — CID 110949844
2-methyl-1-[2-(4-methyl-1H-indol-3-yl)ethyl]-3-(1-phenylethyl)guanidine (PubChem CID 110949844) has the molecular formula C21H26N4 and a molecular weight of 334.47 g/mol. Its IUPAC name is 2-methyl-1-[2-(4-methyl-1H-indol-3-yl)ethyl]-3-(1-phenylethyl)guanidine.
| Compound Name | 2-methyl-1-[2-(4-methyl-1H-indol-3-yl)ethyl]-3-(1-phenylethyl)guanidine |
|---|---|
| PubChem CID | 110949844 |
| Molecular Formula | C21H26N4 |
| Molecular Weight | 334.47 g/mol |
| Exact Mass | 334.22 |
| IUPAC Name | 2-methyl-1-[2-(4-methyl-1H-indol-3-yl)ethyl]-3-(1-phenylethyl)guanidine |
| SMILES | C/N=C(/NCCc1c[nH]c2cccc(C)c12)NC(C)c1ccccc1 |
| InChI | InChI=1S/C21H26N4/c1-15-8-7-11-19-20(15)18(14-24-19)12-13-23-21(22-3)25-16(2)17-9-5-4-6-10-17/h4-11,14,16,24H,12-13H2,1-3H3,(H2,22,23,25) |
| InChIKey | UDWNLZCHCSHMHY-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 52.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.47 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|