About (3-hydroxyphenyl)methyl acetate
(3-hydroxyphenyl)methyl acetate (PubChem CID 11094990) has the molecular formula C9H10O3
and a molecular weight of 166.18 g/mol. Its IUPAC name is (3-hydroxyphenyl)methyl acetate.
Molecular Properties
| Compound Name | (3-hydroxyphenyl)methyl acetate |
| PubChem CID | 11094990 |
| Molecular Formula | C9H10O3 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | (3-hydroxyphenyl)methyl acetate |
| SMILES | CC(=O)OCc1cccc(O)c1 |
| InChI | InChI=1S/C9H10O3/c1-7(10)12-6-8-3-2-4-9(11)5-8/h2-5,11H,6H2,1H3 |
| InChIKey | OUIXENXOUKVZBO-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3-hydroxyphenyl)methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-hydroxyphenyl)methyl acetate?
The IUPAC name of (3-hydroxyphenyl)methyl acetate (CID 11094990) is (3-hydroxyphenyl)methyl acetate.
What is the SMILES notation for (3-hydroxyphenyl)methyl acetate?
The canonical SMILES for (3-hydroxyphenyl)methyl acetate is CC(=O)OCc1cccc(O)c1.
What is the InChIKey of (3-hydroxyphenyl)methyl acetate?
The InChIKey is OUIXENXOUKVZBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O3/c1-7(10)12-6-8-3-2-4-9(11)5-8/h2-5,11H,6H2,1H3.
What are the key properties of (3-hydroxyphenyl)methyl acetate?
(3-hydroxyphenyl)methyl acetate has a molecular weight of 166.18 g/mol, XLogP of 1.46, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-hydroxyphenyl)methyl acetate is sourced from PubChem (CID 11094990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).