About 2,1,3-benzothiadiazole-4,7-diamine
2,1,3-benzothiadiazole-4,7-diamine (PubChem CID 11094993) has the molecular formula C6H6N4S
and a molecular weight of 166.21 g/mol. Its IUPAC name is 2,1,3-benzothiadiazole-4,7-diamine.
Molecular Properties
| Compound Name | 2,1,3-benzothiadiazole-4,7-diamine |
| PubChem CID | 11094993 |
| Molecular Formula | C6H6N4S |
| Molecular Weight | 166.21 g/mol |
| Exact Mass | 166.03 |
| IUPAC Name | 2,1,3-benzothiadiazole-4,7-diamine |
| SMILES | Nc1ccc(N)c2nsnc12 |
| InChI | InChI=1S/C6H6N4S/c7-3-1-2-4(8)6-5(3)9-11-10-6/h1-2H,7-8H2 |
| InChIKey | YMLZIRYFWNLCQS-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.21 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2,1,3-benzothiadiazole-4,7-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,1,3-benzothiadiazole-4,7-diamine?
The IUPAC name of 2,1,3-benzothiadiazole-4,7-diamine (CID 11094993) is 2,1,3-benzothiadiazole-4,7-diamine.
What is the SMILES notation for 2,1,3-benzothiadiazole-4,7-diamine?
The canonical SMILES for 2,1,3-benzothiadiazole-4,7-diamine is Nc1ccc(N)c2nsnc12.
What is the InChIKey of 2,1,3-benzothiadiazole-4,7-diamine?
The InChIKey is YMLZIRYFWNLCQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N4S/c7-3-1-2-4(8)6-5(3)9-11-10-6/h1-2H,7-8H2.
What are the key properties of 2,1,3-benzothiadiazole-4,7-diamine?
2,1,3-benzothiadiazole-4,7-diamine has a molecular weight of 166.21 g/mol, XLogP of 0.86, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,1,3-benzothiadiazole-4,7-diamine is sourced from PubChem (CID 11094993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).