C22H32N6O2S — CID 110950896
1-benzyl-3-ethyl-1-methyl-2-[2-(4-pyridin-2-ylpiperazin-1-yl)sulfonylethyl]guanidine (PubChem CID 110950896) has the molecular formula C22H32N6O2S and a molecular weight of 444.61 g/mol. Its IUPAC name is 1-benzyl-3-ethyl-1-methyl-2-[2-(4-pyridin-2-ylpiperazin-1-yl)sulfonylethyl]guanidine.
| Compound Name | 1-benzyl-3-ethyl-1-methyl-2-[2-(4-pyridin-2-ylpiperazin-1-yl)sulfonylethyl]guanidine |
|---|---|
| PubChem CID | 110950896 |
| Molecular Formula | C22H32N6O2S |
| Molecular Weight | 444.61 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | 1-benzyl-3-ethyl-1-methyl-2-[2-(4-pyridin-2-ylpiperazin-1-yl)sulfonylethyl]guanidine |
| SMILES | CCN/C(=N\CCS(=O)(=O)N1CCN(c2ccccn2)CC1)N(C)Cc1ccccc1 |
| InChI | InChI=1S/C22H32N6O2S/c1-3-23-22(26(2)19-20-9-5-4-6-10-20)25-13-18-31(29,30)28-16-14-27(15-17-28)21-11-7-8-12-24-21/h4-12H,3,13-19H2,1-2H3,(H,23,25) |
| InChIKey | RZBMNKDNEKVCBI-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.61 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|