C18H28IN5 — CID 110951907
1-benzyl-3-ethyl-1-methyl-2-[3-(5-methyl-1H-pyrazol-4-yl)propyl]guanidine;hydroiodide (PubChem CID 110951907) has the molecular formula C18H28IN5 and a molecular weight of 441.36 g/mol. Its IUPAC name is 1-benzyl-3-ethyl-1-methyl-2-[3-(5-methyl-1H-pyrazol-4-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-benzyl-3-ethyl-1-methyl-2-[3-(5-methyl-1H-pyrazol-4-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110951907 |
| Molecular Formula | C18H28IN5 |
| Molecular Weight | 441.36 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | 1-benzyl-3-ethyl-1-methyl-2-[3-(5-methyl-1H-pyrazol-4-yl)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCc1cn[nH]c1C)N(C)Cc1ccccc1.I |
| InChI | InChI=1S/C18H27N5.HI/c1-4-19-18(23(3)14-16-9-6-5-7-10-16)20-12-8-11-17-13-21-22-15(17)2;/h5-7,9-10,13H,4,8,11-12,14H2,1-3H3,(H,19,20)(H,21,22);1H |
| InChIKey | OPRAMDHDGHLSNU-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 56.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.36 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|