C11H19NO — CID 11095241
(E)-3-cyclohexyl-N,N-dimethylprop-2-enamide (PubChem CID 11095241) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is (E)-3-cyclohexyl-N,N-dimethylprop-2-enamide.
| Compound Name | (E)-3-cyclohexyl-N,N-dimethylprop-2-enamide |
|---|---|
| PubChem CID | 11095241 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | (E)-3-cyclohexyl-N,N-dimethylprop-2-enamide |
| SMILES | CN(C)C(=O)/C=C/C1CCCCC1 |
| InChI | InChI=1S/C11H19NO/c1-12(2)11(13)9-8-10-6-4-3-5-7-10/h8-10H,3-7H2,1-2H3/b9-8+ |
| InChIKey | UDPXLRPWODBUNQ-CMDGGOBGSA-N |
| XLogP | 2.21 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|