C11H19NO — CID 11095242
(5S,8aR)-5-[(E)-2-methoxyethenyl]-1,2,3,5,6,7,8,8a-octahydroindolizine (PubChem CID 11095242) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is (5S,8aR)-5-[(E)-2-methoxyethenyl]-1,2,3,5,6,7,8,8a-octahydroindolizine.
| Compound Name | (5S,8aR)-5-[(E)-2-methoxyethenyl]-1,2,3,5,6,7,8,8a-octahydroindolizine |
|---|---|
| PubChem CID | 11095242 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | (5S,8aR)-5-[(E)-2-methoxyethenyl]-1,2,3,5,6,7,8,8a-octahydroindolizine |
| SMILES | CO/C=C/[C@@H]1CCC[C@@H]2CCCN21 |
| InChI | InChI=1S/C11H19NO/c1-13-9-7-11-5-2-4-10-6-3-8-12(10)11/h7,9-11H,2-6,8H2,1H3/b9-7+/t10-,11+/m1/s1 |
| InChIKey | POPUAQYAWGPAIL-HDNGXNTCSA-N |
| XLogP | 2.16 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|