C11H14O3 — CID 11095496
methyl (1S,2R,3S,4R)-3-[(2S)-oxiran-2-yl]bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 11095496) has the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. Its IUPAC name is methyl (1S,2R,3S,4R)-3-[(2S)-oxiran-2-yl]bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | methyl (1S,2R,3S,4R)-3-[(2S)-oxiran-2-yl]bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 11095496 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | methyl (1S,2R,3S,4R)-3-[(2S)-oxiran-2-yl]bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | COC(=O)[C@H]1[C@@H]([C@H]2CO2)[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C11H14O3/c1-13-11(12)10-7-3-2-6(4-7)9(10)8-5-14-8/h2-3,6-10H,4-5H2,1H3/t6-,7+,8+,9+,10+/m0/s1 |
| InChIKey | PACKMMJZLDAPIG-VAPHQMJDSA-N |
| XLogP | 1.00 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|