About methyl (Z)-4-oxodec-7-enoate
methyl (Z)-4-oxodec-7-enoate (PubChem CID 11095590) has the molecular formula C11H18O3
and a molecular weight of 198.26 g/mol. Its IUPAC name is methyl (Z)-4-oxodec-7-enoate.
Molecular Properties
| Compound Name | methyl (Z)-4-oxodec-7-enoate |
| PubChem CID | 11095590 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | methyl (Z)-4-oxodec-7-enoate |
| SMILES | CC/C=C\CCC(=O)CCC(=O)OC |
| InChI | InChI=1S/C11H18O3/c1-3-4-5-6-7-10(12)8-9-11(13)14-2/h4-5H,3,6-9H2,1-2H3/b5-4- |
| InChIKey | JDGUMUBITAJUDP-PLNGDYQASA-N |
| XLogP | 2.26 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl (Z)-4-oxodec-7-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (Z)-4-oxodec-7-enoate?
The IUPAC name of methyl (Z)-4-oxodec-7-enoate (CID 11095590) is methyl (Z)-4-oxodec-7-enoate.
What is the SMILES notation for methyl (Z)-4-oxodec-7-enoate?
The canonical SMILES for methyl (Z)-4-oxodec-7-enoate is CC/C=C\CCC(=O)CCC(=O)OC.
What is the InChIKey of methyl (Z)-4-oxodec-7-enoate?
The InChIKey is JDGUMUBITAJUDP-PLNGDYQASA-N. The full InChI is InChI=1S/C11H18O3/c1-3-4-5-6-7-10(12)8-9-11(13)14-2/h4-5H,3,6-9H2,1-2H3/b5-4-.
What are the key properties of methyl (Z)-4-oxodec-7-enoate?
methyl (Z)-4-oxodec-7-enoate has a molecular weight of 198.26 g/mol, XLogP of 2.26, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (Z)-4-oxodec-7-enoate is sourced from PubChem (CID 11095590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).