About (2R)-2-methyl-4-[(3R)-2,2,3-trimethylcyclopentyl]butan-1-ol
(2R)-2-methyl-4-[(3R)-2,2,3-trimethylcyclopentyl]butan-1-ol (PubChem CID 11095605) has the molecular formula C13H26O
and a molecular weight of 198.35 g/mol. Its IUPAC name is (2R)-2-methyl-4-[(3R)-2,2,3-trimethylcyclopentyl]butan-1-ol.
Molecular Properties
| Compound Name | (2R)-2-methyl-4-[(3R)-2,2,3-trimethylcyclopentyl]butan-1-ol |
| PubChem CID | 11095605 |
| Molecular Formula | C13H26O |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.20 |
| IUPAC Name | (2R)-2-methyl-4-[(3R)-2,2,3-trimethylcyclopentyl]butan-1-ol |
| SMILES | C[C@@H](CO)CCC1CC[C@@H](C)C1(C)C |
| InChI | InChI=1S/C13H26O/c1-10(9-14)5-7-12-8-6-11(2)13(12,3)4/h10-12,14H,5-9H2,1-4H3/t10-,11-,12?/m1/s1 |
| InChIKey | DNRMDFBCDHYZSU-XFKKCKKNSA-N |
| XLogP | 3.47 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2R)-2-methyl-4-[(3R)-2,2,3-trimethylcyclopentyl]butan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-methyl-4-[(3R)-2,2,3-trimethylcyclopentyl]butan-1-ol?
The IUPAC name of (2R)-2-methyl-4-[(3R)-2,2,3-trimethylcyclopentyl]butan-1-ol (CID 11095605) is (2R)-2-methyl-4-[(3R)-2,2,3-trimethylcyclopentyl]butan-1-ol.
What is the SMILES notation for (2R)-2-methyl-4-[(3R)-2,2,3-trimethylcyclopentyl]butan-1-ol?
The canonical SMILES for (2R)-2-methyl-4-[(3R)-2,2,3-trimethylcyclopentyl]butan-1-ol is C[C@@H](CO)CCC1CC[C@@H](C)C1(C)C.
What is the InChIKey of (2R)-2-methyl-4-[(3R)-2,2,3-trimethylcyclopentyl]butan-1-ol?
The InChIKey is DNRMDFBCDHYZSU-XFKKCKKNSA-N. The full InChI is InChI=1S/C13H26O/c1-10(9-14)5-7-12-8-6-11(2)13(12,3)4/h10-12,14H,5-9H2,1-4H3/t10-,11-,12?/m1/s1.
What are the key properties of (2R)-2-methyl-4-[(3R)-2,2,3-trimethylcyclopentyl]butan-1-ol?
(2R)-2-methyl-4-[(3R)-2,2,3-trimethylcyclopentyl]butan-1-ol has a molecular weight of 198.35 g/mol, XLogP of 3.47, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-methyl-4-[(3R)-2,2,3-trimethylcyclopentyl]butan-1-ol is sourced from PubChem (CID 11095605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).