About [(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl butanoate
[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl butanoate (PubChem CID 11095677) has the molecular formula C10H18O4
and a molecular weight of 202.25 g/mol. Its IUPAC name is [(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl butanoate.
Molecular Properties
| Compound Name | [(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl butanoate |
| PubChem CID | 11095677 |
| Molecular Formula | C10H18O4 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | [(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl butanoate |
| SMILES | CCCC(=O)OC[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C10H18O4/c1-4-5-9(11)12-6-8-7-13-10(2,3)14-8/h8H,4-7H2,1-3H3/t8-/m0/s1 |
| InChIKey | JMMOQNCIYAMRDB-QMMMGPOBSA-N |
| XLogP | 1.48 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl butanoate?
The IUPAC name of [(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl butanoate (CID 11095677) is [(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl butanoate.
What is the SMILES notation for [(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl butanoate?
The canonical SMILES for [(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl butanoate is CCCC(=O)OC[C@H]1COC(C)(C)O1.
What is the InChIKey of [(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl butanoate?
The InChIKey is JMMOQNCIYAMRDB-QMMMGPOBSA-N. The full InChI is InChI=1S/C10H18O4/c1-4-5-9(11)12-6-8-7-13-10(2,3)14-8/h8H,4-7H2,1-3H3/t8-/m0/s1.
What are the key properties of [(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl butanoate?
[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl butanoate has a molecular weight of 202.25 g/mol, XLogP of 1.48, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl butanoate is sourced from PubChem (CID 11095677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).