About N,1-dicyclohexylethanimine
N,1-dicyclohexylethanimine (PubChem CID 11095814) has the molecular formula C14H25N
and a molecular weight of 207.36 g/mol. Its IUPAC name is N,1-dicyclohexylethanimine.
Molecular Properties
| Compound Name | N,1-dicyclohexylethanimine |
| PubChem CID | 11095814 |
| Molecular Formula | C14H25N |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.20 |
| IUPAC Name | N,1-dicyclohexylethanimine |
| SMILES | C/C(=N\C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C14H25N/c1-12(13-8-4-2-5-9-13)15-14-10-6-3-7-11-14/h13-14H,2-11H2,1H3/b15-12+ |
| InChIKey | JLMSFOINTNSCGX-NTCAYCPXSA-N |
| XLogP | 4.36 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N,1-dicyclohexylethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,1-dicyclohexylethanimine?
The IUPAC name of N,1-dicyclohexylethanimine (CID 11095814) is N,1-dicyclohexylethanimine.
What is the SMILES notation for N,1-dicyclohexylethanimine?
The canonical SMILES for N,1-dicyclohexylethanimine is C/C(=N\C1CCCCC1)C1CCCCC1.
What is the InChIKey of N,1-dicyclohexylethanimine?
The InChIKey is JLMSFOINTNSCGX-NTCAYCPXSA-N. The full InChI is InChI=1S/C14H25N/c1-12(13-8-4-2-5-9-13)15-14-10-6-3-7-11-14/h13-14H,2-11H2,1H3/b15-12+.
What are the key properties of N,1-dicyclohexylethanimine?
N,1-dicyclohexylethanimine has a molecular weight of 207.36 g/mol, XLogP of 4.36, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,1-dicyclohexylethanimine is sourced from PubChem (CID 11095814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).