C19H28IN5 — CID 110958222
1-cyclohexyl-3-[[4-(imidazol-1-ylmethyl)phenyl]methyl]-2-methylguanidine;hydroiodide (PubChem CID 110958222) has the molecular formula C19H28IN5 and a molecular weight of 453.37 g/mol. Its IUPAC name is 1-cyclohexyl-3-[[4-(imidazol-1-ylmethyl)phenyl]methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-cyclohexyl-3-[[4-(imidazol-1-ylmethyl)phenyl]methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110958222 |
| Molecular Formula | C19H28IN5 |
| Molecular Weight | 453.37 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | 1-cyclohexyl-3-[[4-(imidazol-1-ylmethyl)phenyl]methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(Cn2ccnc2)cc1)NC1CCCCC1.I |
| InChI | InChI=1S/C19H27N5.HI/c1-20-19(23-18-5-3-2-4-6-18)22-13-16-7-9-17(10-8-16)14-24-12-11-21-15-24;/h7-12,15,18H,2-6,13-14H2,1H3,(H2,20,22,23);1H |
| InChIKey | UHKPBLKGTIDQHI-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.37 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|