C13H26IN3O2 — CID 110958638
methyl 3-[(N-cyclohexyl-N'-methylcarbamimidoyl)amino]-2-methylpropanoate;hydroiodide (PubChem CID 110958638) has the molecular formula C13H26IN3O2 and a molecular weight of 383.27 g/mol. Its IUPAC name is methyl 3-[(N-cyclohexyl-N'-methylcarbamimidoyl)amino]-2-methylpropanoate;hydroiodide.
| Compound Name | methyl 3-[(N-cyclohexyl-N'-methylcarbamimidoyl)amino]-2-methylpropanoate;hydroiodide |
|---|---|
| PubChem CID | 110958638 |
| Molecular Formula | C13H26IN3O2 |
| Molecular Weight | 383.27 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | methyl 3-[(N-cyclohexyl-N'-methylcarbamimidoyl)amino]-2-methylpropanoate;hydroiodide |
| SMILES | C/N=C(\NCC(C)C(=O)OC)NC1CCCCC1.I |
| InChI | InChI=1S/C13H25N3O2.HI/c1-10(12(17)18-3)9-15-13(14-2)16-11-7-5-4-6-8-11;/h10-11H,4-9H2,1-3H3,(H2,14,15,16);1H |
| InChIKey | PUOFXMZFUUCICP-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.27 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|