About (E)-8-(3,3-dimethyloxiran-2-yl)-6-methyloct-5-en-2-one
(E)-8-(3,3-dimethyloxiran-2-yl)-6-methyloct-5-en-2-one (PubChem CID 11095895) has the molecular formula C13H22O2
and a molecular weight of 210.32 g/mol. Its IUPAC name is (E)-8-(3,3-dimethyloxiran-2-yl)-6-methyloct-5-en-2-one.
Molecular Properties
| Compound Name | (E)-8-(3,3-dimethyloxiran-2-yl)-6-methyloct-5-en-2-one |
| PubChem CID | 11095895 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | (E)-8-(3,3-dimethyloxiran-2-yl)-6-methyloct-5-en-2-one |
| SMILES | CC(=O)CC/C=C(\C)CCC1OC1(C)C |
| InChI | InChI=1S/C13H22O2/c1-10(6-5-7-11(2)14)8-9-12-13(3,4)15-12/h6,12H,5,7-9H2,1-4H3/b10-6+ |
| InChIKey | ISLYXXWUPOCIOG-UXBLZVDNSA-N |
| XLogP | 3.26 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (E)-8-(3,3-dimethyloxiran-2-yl)-6-methyloct-5-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-8-(3,3-dimethyloxiran-2-yl)-6-methyloct-5-en-2-one?
The IUPAC name of (E)-8-(3,3-dimethyloxiran-2-yl)-6-methyloct-5-en-2-one (CID 11095895) is (E)-8-(3,3-dimethyloxiran-2-yl)-6-methyloct-5-en-2-one.
What is the SMILES notation for (E)-8-(3,3-dimethyloxiran-2-yl)-6-methyloct-5-en-2-one?
The canonical SMILES for (E)-8-(3,3-dimethyloxiran-2-yl)-6-methyloct-5-en-2-one is CC(=O)CC/C=C(\C)CCC1OC1(C)C.
What is the InChIKey of (E)-8-(3,3-dimethyloxiran-2-yl)-6-methyloct-5-en-2-one?
The InChIKey is ISLYXXWUPOCIOG-UXBLZVDNSA-N. The full InChI is InChI=1S/C13H22O2/c1-10(6-5-7-11(2)14)8-9-12-13(3,4)15-12/h6,12H,5,7-9H2,1-4H3/b10-6+.
What are the key properties of (E)-8-(3,3-dimethyloxiran-2-yl)-6-methyloct-5-en-2-one?
(E)-8-(3,3-dimethyloxiran-2-yl)-6-methyloct-5-en-2-one has a molecular weight of 210.32 g/mol, XLogP of 3.26, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-8-(3,3-dimethyloxiran-2-yl)-6-methyloct-5-en-2-one is sourced from PubChem (CID 11095895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).