About (2-chloro-5,5-dimethyl-3-oxocyclohexen-1-yl) acetate
(2-chloro-5,5-dimethyl-3-oxocyclohexen-1-yl) acetate (PubChem CID 11096037) has the molecular formula C10H13ClO3
and a molecular weight of 216.66 g/mol. Its IUPAC name is (2-chloro-5,5-dimethyl-3-oxocyclohexen-1-yl) acetate.
Molecular Properties
| Compound Name | (2-chloro-5,5-dimethyl-3-oxocyclohexen-1-yl) acetate |
| PubChem CID | 11096037 |
| Molecular Formula | C10H13ClO3 |
| Molecular Weight | 216.66 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | (2-chloro-5,5-dimethyl-3-oxocyclohexen-1-yl) acetate |
| SMILES | CC(=O)OC1=C(Cl)C(=O)CC(C)(C)C1 |
| InChI | InChI=1S/C10H13ClO3/c1-6(12)14-8-5-10(2,3)4-7(13)9(8)11/h4-5H2,1-3H3 |
| InChIKey | GSSMPLBNPAHWAS-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.66 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|
Analyze (2-chloro-5,5-dimethyl-3-oxocyclohexen-1-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chloro-5,5-dimethyl-3-oxocyclohexen-1-yl) acetate?
The IUPAC name of (2-chloro-5,5-dimethyl-3-oxocyclohexen-1-yl) acetate (CID 11096037) is (2-chloro-5,5-dimethyl-3-oxocyclohexen-1-yl) acetate.
What is the SMILES notation for (2-chloro-5,5-dimethyl-3-oxocyclohexen-1-yl) acetate?
The canonical SMILES for (2-chloro-5,5-dimethyl-3-oxocyclohexen-1-yl) acetate is CC(=O)OC1=C(Cl)C(=O)CC(C)(C)C1.
What is the InChIKey of (2-chloro-5,5-dimethyl-3-oxocyclohexen-1-yl) acetate?
The InChIKey is GSSMPLBNPAHWAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13ClO3/c1-6(12)14-8-5-10(2,3)4-7(13)9(8)11/h4-5H2,1-3H3.
What are the key properties of (2-chloro-5,5-dimethyl-3-oxocyclohexen-1-yl) acetate?
(2-chloro-5,5-dimethyl-3-oxocyclohexen-1-yl) acetate has a molecular weight of 216.66 g/mol, XLogP of 2.39, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chloro-5,5-dimethyl-3-oxocyclohexen-1-yl) acetate is sourced from PubChem (CID 11096037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).