About 4-butoxypteridin-2-amine
4-butoxypteridin-2-amine (PubChem CID 11096109) has the molecular formula C10H13N5O
and a molecular weight of 219.25 g/mol. Its IUPAC name is 4-butoxypteridin-2-amine.
Molecular Properties
| Compound Name | 4-butoxypteridin-2-amine |
| PubChem CID | 11096109 |
| Molecular Formula | C10H13N5O |
| Molecular Weight | 219.25 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | 4-butoxypteridin-2-amine |
| SMILES | CCCCOc1nc(N)nc2nccnc12 |
| InChI | InChI=1S/C10H13N5O/c1-2-3-6-16-9-7-8(13-5-4-12-7)14-10(11)15-9/h4-5H,2-3,6H2,1H3,(H2,11,13,14,15) |
| InChIKey | NRHQJTUJFPMQBC-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 86.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.25 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-butoxypteridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butoxypteridin-2-amine?
The IUPAC name of 4-butoxypteridin-2-amine (CID 11096109) is 4-butoxypteridin-2-amine.
What is the SMILES notation for 4-butoxypteridin-2-amine?
The canonical SMILES for 4-butoxypteridin-2-amine is CCCCOc1nc(N)nc2nccnc12.
What is the InChIKey of 4-butoxypteridin-2-amine?
The InChIKey is NRHQJTUJFPMQBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N5O/c1-2-3-6-16-9-7-8(13-5-4-12-7)14-10(11)15-9/h4-5H,2-3,6H2,1H3,(H2,11,13,14,15).
What are the key properties of 4-butoxypteridin-2-amine?
4-butoxypteridin-2-amine has a molecular weight of 219.25 g/mol, XLogP of 1.18, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butoxypteridin-2-amine is sourced from PubChem (CID 11096109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).