C22H28N6 — CID 110961655
N-ethyl-N'-(2-imidazo[1,2-a]pyridin-2-ylethyl)-4-phenylpiperazine-1-carboximidamide (PubChem CID 110961655) has the molecular formula C22H28N6 and a molecular weight of 376.51 g/mol. Its IUPAC name is N-ethyl-N'-(2-imidazo[1,2-a]pyridin-2-ylethyl)-4-phenylpiperazine-1-carboximidamide.
| Compound Name | N-ethyl-N'-(2-imidazo[1,2-a]pyridin-2-ylethyl)-4-phenylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 110961655 |
| Molecular Formula | C22H28N6 |
| Molecular Weight | 376.51 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | N-ethyl-N'-(2-imidazo[1,2-a]pyridin-2-ylethyl)-4-phenylpiperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCc1cn2ccccc2n1)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C22H28N6/c1-2-23-22(24-12-11-19-18-28-13-7-6-10-21(28)25-19)27-16-14-26(15-17-27)20-8-4-3-5-9-20/h3-10,13,18H,2,11-12,14-17H2,1H3,(H,23,24) |
| InChIKey | UIAJMQYMJQCFQO-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 48.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.51 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|