About 2-methyl-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine
2-methyl-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine (PubChem CID 11096174) has the molecular formula C8H11N3
and a molecular weight of 149.20 g/mol. Its IUPAC name is 2-methyl-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine.
Analyze 2-methyl-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine?
The IUPAC name of 2-methyl-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine (CID 11096174) is 2-methyl-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine.
What is the SMILES notation for 2-methyl-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine?
The canonical SMILES for 2-methyl-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine is Cc1ncc2c(n1)CCNC2.
What is the InChIKey of 2-methyl-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine?
The InChIKey is WFGUTPUYXDVQLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3/c1-6-10-5-7-4-9-3-2-8(7)11-6/h5,9H,2-4H2,1H3.
What are the key properties of 2-methyl-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine?
2-methyl-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine has a molecular weight of 149.20 g/mol, XLogP of 0.43, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine is sourced from PubChem (CID 11096174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).