methyl 6-chloro-1,2,3,4-tetrahydroquinoline-2-carboxylate

C11H12ClNO2 — CID 11096285

IUPACmethyl 6-chloro-1,2,3,4-tetrahydroquinoline-2-carboxylate
SMILESCOC(=O)C1CCc2cc(Cl)ccc2N1
InChIInChI=1S/C11H12ClNO2/c1-15-11(14)10-4-2-7-6-8(12)3-5-9(7)13-10/h3,5-6,10,13H,2,4H2,1H3
InChIKeyOBBQDOBQFRAXJS-UHFFFAOYSA-N
MW225.68 g/mol
LogP2.24
Rot. Bonds1

About methyl 6-chloro-1,2,3,4-tetrahydroquinoline-2-carboxylate

methyl 6-chloro-1,2,3,4-tetrahydroquinoline-2-carboxylate (PubChem CID 11096285) has the molecular formula C11H12ClNO2 and a molecular weight of 225.68 g/mol. Its IUPAC name is methyl 6-chloro-1,2,3,4-tetrahydroquinoline-2-carboxylate.

Molecular Properties

Compound Namemethyl 6-chloro-1,2,3,4-tetrahydroquinoline-2-carboxylate
PubChem CID11096285
Molecular FormulaC11H12ClNO2
Molecular Weight225.68 g/mol
Exact Mass225.06
IUPAC Namemethyl 6-chloro-1,2,3,4-tetrahydroquinoline-2-carboxylate
SMILESCOC(=O)C1CCc2cc(Cl)ccc2N1
InChIInChI=1S/C11H12ClNO2/c1-15-11(14)10-4-2-7-6-8(12)3-5-9(7)13-10/h3,5-6,10,13H,2,4H2,1H3
InChIKeyOBBQDOBQFRAXJS-UHFFFAOYSA-N
XLogP2.24
TPSA38.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500225.68
LogP ≤ 52.24
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl 6-chloro-1,2,3,4-tetrahydroquinoline-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 6-chloro-1,2,3,4-tetrahydroquinoline-2-carboxylate?
The IUPAC name of methyl 6-chloro-1,2,3,4-tetrahydroquinoline-2-carboxylate (CID 11096285) is methyl 6-chloro-1,2,3,4-tetrahydroquinoline-2-carboxylate.
What is the SMILES notation for methyl 6-chloro-1,2,3,4-tetrahydroquinoline-2-carboxylate?
The canonical SMILES for methyl 6-chloro-1,2,3,4-tetrahydroquinoline-2-carboxylate is COC(=O)C1CCc2cc(Cl)ccc2N1.
What is the InChIKey of methyl 6-chloro-1,2,3,4-tetrahydroquinoline-2-carboxylate?
The InChIKey is OBBQDOBQFRAXJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12ClNO2/c1-15-11(14)10-4-2-7-6-8(12)3-5-9(7)13-10/h3,5-6,10,13H,2,4H2,1H3.
What are the key properties of methyl 6-chloro-1,2,3,4-tetrahydroquinoline-2-carboxylate?
methyl 6-chloro-1,2,3,4-tetrahydroquinoline-2-carboxylate has a molecular weight of 225.68 g/mol, XLogP of 2.24, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-chloro-1,2,3,4-tetrahydroquinoline-2-carboxylate is sourced from PubChem (CID 11096285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).