C12H20O4 — CID 11096366
2-[(2R,3R,7S,10R)-2,3,10-trimethyl-1,4,6-trioxaspiro[4.5]decan-7-yl]acetaldehyde (PubChem CID 11096366) has the molecular formula C12H20O4 and a molecular weight of 228.29 g/mol. Its IUPAC name is 2-[(2R,3R,7S,10R)-2,3,10-trimethyl-1,4,6-trioxaspiro[4.5]decan-7-yl]acetaldehyde.
| Compound Name | 2-[(2R,3R,7S,10R)-2,3,10-trimethyl-1,4,6-trioxaspiro[4.5]decan-7-yl]acetaldehyde |
|---|---|
| PubChem CID | 11096366 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 2-[(2R,3R,7S,10R)-2,3,10-trimethyl-1,4,6-trioxaspiro[4.5]decan-7-yl]acetaldehyde |
| SMILES | C[C@@H]1CC[C@@H](CC=O)OC12O[C@H](C)[C@@H](C)O2 |
| InChI | InChI=1S/C12H20O4/c1-8-4-5-11(6-7-13)16-12(8)14-9(2)10(3)15-12/h7-11H,4-6H2,1-3H3/t8-,9-,10-,11+/m1/s1 |
| InChIKey | TYGJNCSZKJOGCV-DBIOUOCHSA-N |
| XLogP | 1.87 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|