About ethyl 4-hydroxy-4,8-dimethylnon-7-enoate
ethyl 4-hydroxy-4,8-dimethylnon-7-enoate (PubChem CID 11096377) has the molecular formula C13H24O3
and a molecular weight of 228.33 g/mol. Its IUPAC name is ethyl 4-hydroxy-4,8-dimethylnon-7-enoate.
Molecular Properties
| Compound Name | ethyl 4-hydroxy-4,8-dimethylnon-7-enoate |
| PubChem CID | 11096377 |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | ethyl 4-hydroxy-4,8-dimethylnon-7-enoate |
| SMILES | CCOC(=O)CCC(C)(O)CCC=C(C)C |
| InChI | InChI=1S/C13H24O3/c1-5-16-12(14)8-10-13(4,15)9-6-7-11(2)3/h7,15H,5-6,8-10H2,1-4H3 |
| InChIKey | UHHPBFVTCVRCIM-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-hydroxy-4,8-dimethylnon-7-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-hydroxy-4,8-dimethylnon-7-enoate?
The IUPAC name of ethyl 4-hydroxy-4,8-dimethylnon-7-enoate (CID 11096377) is ethyl 4-hydroxy-4,8-dimethylnon-7-enoate.
What is the SMILES notation for ethyl 4-hydroxy-4,8-dimethylnon-7-enoate?
The canonical SMILES for ethyl 4-hydroxy-4,8-dimethylnon-7-enoate is CCOC(=O)CCC(C)(O)CCC=C(C)C.
What is the InChIKey of ethyl 4-hydroxy-4,8-dimethylnon-7-enoate?
The InChIKey is UHHPBFVTCVRCIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O3/c1-5-16-12(14)8-10-13(4,15)9-6-7-11(2)3/h7,15H,5-6,8-10H2,1-4H3.
What are the key properties of ethyl 4-hydroxy-4,8-dimethylnon-7-enoate?
ethyl 4-hydroxy-4,8-dimethylnon-7-enoate has a molecular weight of 228.33 g/mol, XLogP of 2.83, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-hydroxy-4,8-dimethylnon-7-enoate is sourced from PubChem (CID 11096377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).