C19H33IN4 — CID 110966961
1-tert-butyl-2-methyl-3-[[2-(piperidin-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 110966961) has the molecular formula C19H33IN4 and a molecular weight of 444.41 g/mol. Its IUPAC name is 1-tert-butyl-2-methyl-3-[[2-(piperidin-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-tert-butyl-2-methyl-3-[[2-(piperidin-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110966961 |
| Molecular Formula | C19H33IN4 |
| Molecular Weight | 444.41 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | 1-tert-butyl-2-methyl-3-[[2-(piperidin-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccccc1CN1CCCCC1)NC(C)(C)C.I |
| InChI | InChI=1S/C19H32N4.HI/c1-19(2,3)22-18(20-4)21-14-16-10-6-7-11-17(16)15-23-12-8-5-9-13-23;/h6-7,10-11H,5,8-9,12-15H2,1-4H3,(H2,20,21,22);1H |
| InChIKey | SORQVIHZSOATDI-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.41 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|