C11H15NO5 — CID 11096752
ethyl (2R)-2-(methoxycarbonylamino)-2-(5-methylfuran-2-yl)acetate (PubChem CID 11096752) has the molecular formula C11H15NO5 and a molecular weight of 241.24 g/mol. Its IUPAC name is ethyl (2R)-2-(methoxycarbonylamino)-2-(5-methylfuran-2-yl)acetate.
| Compound Name | ethyl (2R)-2-(methoxycarbonylamino)-2-(5-methylfuran-2-yl)acetate |
|---|---|
| PubChem CID | 11096752 |
| Molecular Formula | C11H15NO5 |
| Molecular Weight | 241.24 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | ethyl (2R)-2-(methoxycarbonylamino)-2-(5-methylfuran-2-yl)acetate |
| SMILES | CCOC(=O)[C@H](NC(=O)OC)c1ccc(C)o1 |
| InChI | InChI=1S/C11H15NO5/c1-4-16-10(13)9(12-11(14)15-3)8-6-5-7(2)17-8/h5-6,9H,4H2,1-3H3,(H,12,14)/t9-/m1/s1 |
| InChIKey | SDZULYHTCYAEEF-SECBINFHSA-N |
| XLogP | 1.55 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.24 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |