C14H20N6O — CID 110969252
1-ethyl-3-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]-2-(pyridin-2-ylmethyl)guanidine (PubChem CID 110969252) has the molecular formula C14H20N6O and a molecular weight of 288.35 g/mol. Its IUPAC name is 1-ethyl-3-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]-2-(pyridin-2-ylmethyl)guanidine.
| Compound Name | 1-ethyl-3-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]-2-(pyridin-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 110969252 |
| Molecular Formula | C14H20N6O |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | 1-ethyl-3-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]-2-(pyridin-2-ylmethyl)guanidine |
| SMILES | CCN/C(=N\Cc1ccccn1)NCCc1nc(C)no1 |
| InChI | InChI=1S/C14H20N6O/c1-3-15-14(18-10-12-6-4-5-8-16-12)17-9-7-13-19-11(2)20-21-13/h4-6,8H,3,7,9-10H2,1-2H3,(H2,15,17,18) |
| InChIKey | HBPKFDSVXWSYAP-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 88.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|